1-Chloro-2-methylanthraquinone

Good factory supply good 1-Chloro-2-methylanthraquinone 129-35-1 We provide high quality 1-Chloro-2-methylanthraquinone (CAS 129-35-1), at a very affordable prices to our customers.

1.What is the 1-Chloro-2-methylanthraquinone ?

1-Chloro-2-methylanthraquinone is a chemical compound that belongs to the class of organic compounds known as anthraquinones. This class is characterized by a three-ring structure of conjugated cyclol systems and keto and hydroxyl groups. As suggested by its name, this chemical has a chlorine atom and a methyl group attached to its anthraquinone structure. It is used in the synthesis of dyes and pigments due to its bright color and stability, and can be used in various chemical reactions due to its reactivity. Essentially, it serves as a functional compound in the field of organic chemistry. Its exact properties like solubility or melting point may vary depending on the specific conditions.

Used in Dye and Pigment Industry:
1-Chloro-2-methylanthraquinone is used as a chemical intermediate for the synthesis of dyes and pigments for its bright color and stability. It contributes to the production of colorants that are used in various applications, such as textiles, plastics, and paints.
Used in Organic Chemistry Research:
1-Chloro-2-methylanthraquinone is used as a reagent in various chemical reactions, allowing for the synthesis of new compounds and the study of reaction mechanisms. Its reactivity makes it a valuable tool in the development of novel organic compounds and materials.

2.What is the CAS number for 1-Chloro-2-methylanthraquinone ?

The CAS number of 1-Chloro-2-methylanthraquinone is 129-35-1.

More information of 1-Chloro-2-methylanthraquinone 129-35-1 are:

3.What is the molecular formula of 1-Chloro-2-methylanthraquinone ?

The chemical formula of?1-Chloro-2-methylanthraquinone is C15H9ClO2 which containing 15 Carbon atoms,9 Hydrogen atoms,1 Chlorine atoms and 2 Oxygen atoms,and the molecular weight, and the molecular weight of 1-Chloro-2-methylanthraquinone is 256.688

4.What is 1-Chloro-2-methylanthraquinone(129-35-1)used for?

1-Chloro-2-methylanthraquinone is a chemical compound that belongs to the class of organic compounds known as anthraquinones. This class is characterized by a three-ring structure of conjugated cyclol systems and keto and hydroxyl groups. As suggested by its name, this chemical has a chlorine atom and a methyl group attached to its anthraquinone structure. It is used in the synthesis of dyes and pigments due to its bright color and stability, and can be used in various chemical reactions due to its reactivity. Essentially, it serves as a functional compound in the field of organic chemistry. Its exact properties like solubility or melting point may vary depending on the specific conditions.

InChI:InChI=1/C15H9ClO2/c1-8-6-7-11-12(13(8)16)15(18)10-5-3-2-4-9(10)14(11)17/h2-7H,1H3

Relevant articles related to 1-Chloro-2-methylanthraquinone:

5.Good factory supply good 1-Chloro-2-methylanthraquinone 129-35-1

ZHUHAI JC BIOLOGICAL TECHNOLOGY CO.,LTd is a quality supplier of 1-Chloro-2-methylanthraquinone. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 1-Chloro-2-methylanthraquinone 129-35-1.